C20H18BrN3O — CID 110532716
(Z)-3-(3-bromo-4-propoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110532716) has the molecular formula C20H18BrN3O and a molecular weight of 396.29 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-propoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-bromo-4-propoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110532716 |
| Molecular Formula | C20H18BrN3O |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (Z)-3-(3-bromo-4-propoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(/C=C(/C#N)c2nc3ccccc3n2C)cc1Br |
| InChI | InChI=1S/C20H18BrN3O/c1-3-10-25-19-9-8-14(12-16(19)21)11-15(13-22)20-23-17-6-4-5-7-18(17)24(20)2/h4-9,11-12H,3,10H2,1-2H3/b15-11- |
| InChIKey | IIJIQSBGPLBJRK-PTNGSMBKSA-N |
| XLogP | 5.19 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|