C20H16BrN3O2 — CID 136781684
(Z)-3-(3-bromo-4-propoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 136781684) has the molecular formula C20H16BrN3O2 and a molecular weight of 410.27 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-propoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-bromo-4-propoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 136781684 |
| Molecular Formula | C20H16BrN3O2 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (Z)-3-(3-bromo-4-propoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(/C=C(/C#N)c2nc3ccccc3c(=O)[nH]2)cc1Br |
| InChI | InChI=1S/C20H16BrN3O2/c1-2-9-26-18-8-7-13(11-16(18)21)10-14(12-22)19-23-17-6-4-3-5-15(17)20(25)24-19/h3-8,10-11H,2,9H2,1H3,(H,23,24,25)/b14-10- |
| InChIKey | YAISVQAMHZCZRD-UVTDQMKNSA-N |
| XLogP | 4.54 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|