C29H22FN5O2 — CID 135602741
(E)-3-[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135602741) has the molecular formula C29H22FN5O2 and a molecular weight of 491.53 g/mol. Its IUPAC name is (E)-3-[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135602741 |
| Molecular Formula | C29H22FN5O2 |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (E)-3-[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)c2nc3ccccc3c(=O)[nH]2)cc1F |
| InChI | InChI=1S/C29H22FN5O2/c1-2-14-37-26-13-12-19(16-24(26)30)27-21(18-35(34-27)22-8-4-3-5-9-22)15-20(17-31)28-32-25-11-7-6-10-23(25)29(36)33-28/h3-13,15-16,18H,2,14H2,1H3,(H,32,33,36)/b20-15+ |
| InChIKey | SREPJNBYPYEALS-HMMYKYKNSA-N |
| XLogP | 5.77 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|