C28H19N5O3 — CID 135461514
3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135461514) has the molecular formula C28H19N5O3 and a molecular weight of 473.49 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135461514 |
| Molecular Formula | C28H19N5O3 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C28H19N5O3/c29-16-19(27-30-23-9-5-4-8-22(23)28(34)31-27)14-20-17-33(21-6-2-1-3-7-21)32-26(20)18-10-11-24-25(15-18)36-13-12-35-24/h1-11,14-15,17H,12-13H2,(H,30,31,34) |
| InChIKey | ZBNYESHNEMLGGD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|