C33H23N5O2 — CID 135602751
(E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enenitrile (PubChem CID 135602751) has the molecular formula C33H23N5O2 and a molecular weight of 521.58 g/mol. Its IUPAC name is (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135602751 |
| Molecular Formula | C33H23N5O2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C33H23N5O2/c34-20-25(32-35-30-14-8-7-13-29(30)33(39)36-32)19-26-21-38(27-11-5-2-6-12-27)37-31(26)24-15-17-28(18-16-24)40-22-23-9-3-1-4-10-23/h1-19,21H,22H2,(H,35,36,39)/b25-19+ |
| InChIKey | XJUNFPHIAARXGV-NCELDCMTSA-N |
| XLogP | 6.42 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|