C26H17N5O — CID 135765506
(E)-3-(1,3-diphenylpyrazol-4-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135765506) has the molecular formula C26H17N5O and a molecular weight of 415.46 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135765506 |
| Molecular Formula | C26H17N5O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccccc1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C26H17N5O/c27-16-19(25-28-23-14-8-7-13-22(23)26(32)29-25)15-20-17-31(21-11-5-2-6-12-21)30-24(20)18-9-3-1-4-10-18/h1-15,17H,(H,28,29,32)/b19-15+ |
| InChIKey | DCJHRUPTPTVUCS-XDJHFCHBSA-N |
| XLogP | 4.84 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|