C20H13N5O — CID 135782234
(E)-2-(4-oxo-3H-quinazolin-2-yl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile (PubChem CID 135782234) has the molecular formula C20H13N5O and a molecular weight of 339.36 g/mol. Its IUPAC name is (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135782234 |
| Molecular Formula | C20H13N5O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (E)-2-(4-oxo-3H-quinazolin-2-yl)-3-(5-phenyl-1H-pyrazol-4-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn[nH]c1-c1ccccc1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H13N5O/c21-11-14(19-23-17-9-5-4-8-16(17)20(26)24-19)10-15-12-22-25-18(15)13-6-2-1-3-7-13/h1-10,12H,(H,22,25)(H,23,24,26)/b14-10+ |
| InChIKey | LSKPYHGOERCRKL-GXDHUFHOSA-N |
| XLogP | 3.38 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|