C17H9ClFN3O — CID 135454440
(E)-3-(2-chloro-6-fluorophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135454440) has the molecular formula C17H9ClFN3O and a molecular weight of 325.73 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135454440 |
| Molecular Formula | C17H9ClFN3O |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c(F)cccc1Cl)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H9ClFN3O/c18-13-5-3-6-14(19)12(13)8-10(9-20)16-21-15-7-2-1-4-11(15)17(23)22-16/h1-8H,(H,21,22,23)/b10-8+ |
| InChIKey | IFZWZSKDPNFQBV-CSKARUKUSA-N |
| XLogP | 3.78 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|