C18H11ClFN3O — CID 135456239
3-(2-chloro-6-fluorophenyl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135456239) has the molecular formula C18H11ClFN3O and a molecular weight of 339.76 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135456239 |
| Molecular Formula | C18H11ClFN3O |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3c(F)cccc3Cl)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C18H11ClFN3O/c1-10-5-6-16-13(7-10)18(24)23-17(22-16)11(9-21)8-12-14(19)3-2-4-15(12)20/h2-8H,1H3,(H,22,23,24) |
| InChIKey | OAXSRXLPKHSZPS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|