C22H15ClN4O2 — CID 135449643
3-(2-chloro-8-methoxyquinolin-3-yl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135449643) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is 3-(2-chloro-8-methoxyquinolin-3-yl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2-chloro-8-methoxyquinolin-3-yl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135449643 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 3-(2-chloro-8-methoxyquinolin-3-yl)-2-(6-methyl-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | COc1cccc2cc(C=C(C#N)c3nc4ccc(C)cc4c(=O)[nH]3)c(Cl)nc12 |
| InChI | InChI=1S/C22H15ClN4O2/c1-12-6-7-17-16(8-12)22(28)27-21(25-17)15(11-24)10-14-9-13-4-3-5-18(29-2)19(13)26-20(14)23/h3-10H,1-2H3,(H,25,27,28) |
| InChIKey | DJKAEMYWWRPHKN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|