C18H12BrN3O3 — CID 135650141
(Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135650141) has the molecular formula C18H12BrN3O3 and a molecular weight of 398.22 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135650141 |
| Molecular Formula | C18H12BrN3O3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | (Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2nc3ccccc3c(=O)[nH]2)cc(Br)c1O |
| InChI | InChI=1S/C18H12BrN3O3/c1-25-15-8-10(7-13(19)16(15)23)6-11(9-20)17-21-14-5-3-2-4-12(14)18(24)22-17/h2-8,23H,1H3,(H,21,22,24)/b11-6- |
| InChIKey | AGNXBMZCCGMJGE-WDZFZDKYSA-N |
| XLogP | 3.46 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|