C21H19N3O2 — CID 136822103
(Z)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 136822103) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (Z)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 136822103 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (Z)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | CC(C)(C)Oc1ccc(/C=C(/C#N)c2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H19N3O2/c1-21(2,3)26-16-10-8-14(9-11-16)12-15(13-22)19-23-18-7-5-4-6-17(18)20(25)24-19/h4-12H,1-3H3,(H,23,24,25)/b15-12- |
| InChIKey | KTXMEJPSZVOZBK-QINSGFPZSA-N |
| XLogP | 4.16 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|