C20H12N4O — CID 135420594
2-(4-oxo-3H-quinazolin-2-yl)-3-quinolin-7-ylprop-2-enenitrile (PubChem CID 135420594) has the molecular formula C20H12N4O and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(4-oxo-3H-quinazolin-2-yl)-3-quinolin-7-ylprop-2-enenitrile.
| Compound Name | 2-(4-oxo-3H-quinazolin-2-yl)-3-quinolin-7-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 135420594 |
| Molecular Formula | C20H12N4O |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(4-oxo-3H-quinazolin-2-yl)-3-quinolin-7-ylprop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc2cccnc2c1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H12N4O/c21-12-15(10-13-7-8-14-4-3-9-22-18(14)11-13)19-23-17-6-2-1-5-16(17)20(25)24-19/h1-11H,(H,23,24,25) |
| InChIKey | LIJJTRQWMTUHPT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|