C17H10N4O4 — CID 135544459
3-(4-hydroxy-3-nitrophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135544459) has the molecular formula C17H10N4O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 3-(4-hydroxy-3-nitrophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(4-hydroxy-3-nitrophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135544459 |
| Molecular Formula | C17H10N4O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-(4-hydroxy-3-nitrophenyl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(O)c([N+](=O)[O-])c1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H10N4O4/c18-9-11(7-10-5-6-15(22)14(8-10)21(24)25)16-19-13-4-2-1-3-12(13)17(23)20-16/h1-8,22H,(H,19,20,23) |
| InChIKey | PYUQKLVTBIRXKR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|