C20H14N4O — CID 136822191
(Z)-3-(2-methyl-1H-indol-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 136822191) has the molecular formula C20H14N4O and a molecular weight of 326.36 g/mol. Its IUPAC name is (Z)-3-(2-methyl-1H-indol-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2-methyl-1H-indol-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 136822191 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (Z)-3-(2-methyl-1H-indol-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1/C=C(/C#N)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H14N4O/c1-12-16(14-6-2-4-8-17(14)22-12)10-13(11-21)19-23-18-9-5-3-7-15(18)20(25)24-19/h2-10,22H,1H3,(H,23,24,25)/b13-10- |
| InChIKey | QADQZLXKHLYLRF-RAXLEYEMSA-N |
| XLogP | 3.78 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|