C17H8Cl3N3O — CID 135508694
2-(4-oxo-3H-quinazolin-2-yl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile (PubChem CID 135508694) has the molecular formula C17H8Cl3N3O and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-(4-oxo-3H-quinazolin-2-yl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile.
| Compound Name | 2-(4-oxo-3H-quinazolin-2-yl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135508694 |
| Molecular Formula | C17H8Cl3N3O |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2-(4-oxo-3H-quinazolin-2-yl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1c(Cl)ccc(Cl)c1Cl)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H8Cl3N3O/c18-12-5-6-13(19)15(20)11(12)7-9(8-21)16-22-14-4-2-1-3-10(14)17(24)23-16/h1-7H,(H,22,23,24) |
| InChIKey | HKFBXGCTNICFFM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|