C21H11Cl2N3O2 — CID 135782248
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135782248) has the molecular formula C21H11Cl2N3O2 and a molecular weight of 408.24 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135782248 |
| Molecular Formula | C21H11Cl2N3O2 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)cc(Cl)c2)o1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H11Cl2N3O2/c22-14-7-12(8-15(23)10-14)19-6-5-16(28-19)9-13(11-24)20-25-18-4-2-1-3-17(18)21(27)26-20/h1-10H,(H,25,26,27)/b13-9+ |
| InChIKey | GMJUAPFSQHCIBJ-UKTHLTGXSA-N |
| XLogP | 5.55 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|