C21H14ClN3O2S — CID 6199314
(E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile (PubChem CID 6199314) has the molecular formula C21H14ClN3O2S and a molecular weight of 407.88 g/mol. Its IUPAC name is (E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6199314 |
| Molecular Formula | C21H14ClN3O2S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile |
| SMILES | Cc1sc2nc(/C(C#N)=C/c3ccc(-c4cccc(Cl)c4)o3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C21H14ClN3O2S/c1-11-12(2)28-21-18(11)20(26)24-19(25-21)14(10-23)9-16-6-7-17(27-16)13-4-3-5-15(22)8-13/h3-9H,1-2H3,(H,24,25,26)/b14-9+ |
| InChIKey | GGELEUIEIAXAHW-NTEUORMPSA-N |
| XLogP | 5.58 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|