C17H12BrN3OS — CID 4006309
3-(3-bromophenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile (PubChem CID 4006309) has the molecular formula C17H12BrN3OS and a molecular weight of 386.27 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(3-bromophenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4006309 |
| Molecular Formula | C17H12BrN3OS |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 3-(3-bromophenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enenitrile |
| SMILES | Cc1sc2nc(C(C#N)=Cc3cccc(Br)c3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H12BrN3OS/c1-9-10(2)23-17-14(9)16(22)20-15(21-17)12(8-19)6-11-4-3-5-13(18)7-11/h3-7H,1-2H3,(H,20,21,22) |
| InChIKey | UICKXBDXEOMPLA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|