C18H13N4O5S- — CID 7912660
4-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate (PubChem CID 7912660) has the molecular formula C18H13N4O5S- and a molecular weight of 397.39 g/mol. Its IUPAC name is 4-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7912660 |
| Molecular Formula | C18H13N4O5S- |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C(\C#N)c2nc3sc(C)c(C)c3c(=O)[nH]2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C18H14N4O5S/c1-8-9(2)28-18-14(8)17(24)20-16(21-18)11(7-19)4-10-5-12(22(25)26)15(23)13(6-10)27-3/h4-6,23H,1-3H3,(H,20,21,24)/p-1/b11-4+ |
| InChIKey | QRNFFSCIVOGEQS-NYYWCZLTSA-M |
| XLogP | 2.66 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|