C24H19N3O4S — CID 6199212
ethyl 4-[5-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]furan-2-yl]benzoate (PubChem CID 6199212) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6199212 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | ethyl 4-[5-[(E)-2-cyano-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(\C#N)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 |
| InChI | InChI=1S/C24H19N3O4S/c1-4-30-24(29)16-7-5-15(6-8-16)19-10-9-18(31-19)11-17(12-25)21-26-22(28)20-13(2)14(3)32-23(20)27-21/h5-11H,4H2,1-3H3,(H,26,27,28)/b17-11+ |
| InChIKey | MTKLSOXWOHRNRE-GZTJUZNOSA-N |
| XLogP | 5.10 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|