C20H15N5O3 — CID 92885726
ethyl 4-[5-[(E)-2-(3-amino-4-cyano-1H-pyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 92885726) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-2-(3-amino-4-cyano-1H-pyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-2-(3-amino-4-cyano-1H-pyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 92885726 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | ethyl 4-[5-[(E)-2-(3-amino-4-cyano-1H-pyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(/C#N)c3[nH]nc(N)c3C#N)o2)cc1 |
| InChI | InChI=1S/C20H15N5O3/c1-2-27-20(26)13-5-3-12(4-6-13)17-8-7-15(28-17)9-14(10-21)18-16(11-22)19(23)25-24-18/h3-9H,2H2,1H3,(H3,23,24,25)/b14-9- |
| InChIKey | JNJVXSICXGVNLM-ZROIWOOFSA-N |
| XLogP | 3.36 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|