C26H19N5O3 — CID 2974830
ethyl 3-[5-[2-(3-amino-4-cyano-1-phenylpyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 2974830) has the molecular formula C26H19N5O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is ethyl 3-[5-[2-(3-amino-4-cyano-1-phenylpyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[2-(3-amino-4-cyano-1-phenylpyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2974830 |
| Molecular Formula | C26H19N5O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | ethyl 3-[5-[2-(3-amino-4-cyano-1-phenylpyrazol-5-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(C=C(C#N)c3c(C#N)c(N)nn3-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C26H19N5O3/c1-2-33-26(32)18-8-6-7-17(13-18)23-12-11-21(34-23)14-19(15-27)24-22(16-28)25(29)30-31(24)20-9-4-3-5-10-20/h3-14H,2H2,1H3,(H2,29,30) |
| InChIKey | VMVATMIGMSJVBH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|