C24H15N5O3 — CID 6196568
4-[5-[(Z)-2-(5-amino-4-cyano-1-phenylpyrazol-3-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid (PubChem CID 6196568) has the molecular formula C24H15N5O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is 4-[5-[(Z)-2-(5-amino-4-cyano-1-phenylpyrazol-3-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(Z)-2-(5-amino-4-cyano-1-phenylpyrazol-3-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6196568 |
| Molecular Formula | C24H15N5O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-[5-[(Z)-2-(5-amino-4-cyano-1-phenylpyrazol-3-yl)-2-cyanoethenyl]furan-2-yl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(C(=O)O)cc2)o1)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C24H15N5O3/c25-13-17(22-20(14-26)23(27)29(28-22)18-4-2-1-3-5-18)12-19-10-11-21(32-19)15-6-8-16(9-7-15)24(30)31/h1-12H,27H2,(H,30,31)/b17-12+ |
| InChIKey | UDICCLPDWBLJFL-SFQUDFHCSA-N |
| XLogP | 4.35 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|