C23H13Cl2N5O — CID 3444686
5-amino-3-[1-cyano-2-[5-(2,6-dichlorophenyl)furan-2-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 3444686) has the molecular formula C23H13Cl2N5O and a molecular weight of 446.30 g/mol. Its IUPAC name is 5-amino-3-[1-cyano-2-[5-(2,6-dichlorophenyl)furan-2-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[1-cyano-2-[5-(2,6-dichlorophenyl)furan-2-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 3444686 |
| Molecular Formula | C23H13Cl2N5O |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 5-amino-3-[1-cyano-2-[5-(2,6-dichlorophenyl)furan-2-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1ccc(-c2c(Cl)cccc2Cl)o1)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C23H13Cl2N5O/c24-18-7-4-8-19(25)21(18)20-10-9-16(31-20)11-14(12-26)22-17(13-27)23(28)30(29-22)15-5-2-1-3-6-15/h1-11H,28H2 |
| InChIKey | KTCASWAOSYCJEZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|