C20H12F3N5 — CID 5334314
5-amino-3-[(Z)-1-cyano-2-[2-(trifluoromethyl)phenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 5334314) has the molecular formula C20H12F3N5 and a molecular weight of 379.35 g/mol. Its IUPAC name is 5-amino-3-[(Z)-1-cyano-2-[2-(trifluoromethyl)phenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-1-cyano-2-[2-(trifluoromethyl)phenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 5334314 |
| Molecular Formula | C20H12F3N5 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-amino-3-[(Z)-1-cyano-2-[2-(trifluoromethyl)phenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#C/C(=C\c1ccccc1C(F)(F)F)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C20H12F3N5/c21-20(22,23)17-9-5-4-6-13(17)10-14(11-24)18-16(12-25)19(26)28(27-18)15-7-2-1-3-8-15/h1-10H,26H2/b14-10+ |
| InChIKey | QNJCQNJXGICOQE-GXDHUFHOSA-N |
| XLogP | 4.41 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|