C23H14BrN5O — CID 3100079
5-amino-3-[2-[5-(4-bromophenyl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 3100079) has the molecular formula C23H14BrN5O and a molecular weight of 456.30 g/mol. Its IUPAC name is 5-amino-3-[2-[5-(4-bromophenyl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[2-[5-(4-bromophenyl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 3100079 |
| Molecular Formula | C23H14BrN5O |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 5-amino-3-[2-[5-(4-bromophenyl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc(Br)cc2)o1)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C23H14BrN5O/c24-17-8-6-15(7-9-17)21-11-10-19(30-21)12-16(13-25)22-20(14-26)23(27)29(28-22)18-4-2-1-3-5-18/h1-12H,27H2 |
| InChIKey | OYYWPZPMYMUJPU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|