C24H14N6OS — CID 3653005
5-amino-3-[2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 3653005) has the molecular formula C24H14N6OS and a molecular weight of 434.48 g/mol. Its IUPAC name is 5-amino-3-[2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 3653005 |
| Molecular Formula | C24H14N6OS |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5-amino-3-[2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1ccc(-c2nc3ccccc3s2)o1)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C24H14N6OS/c25-13-15(22-18(14-26)23(27)30(29-22)16-6-2-1-3-7-16)12-17-10-11-20(31-17)24-28-19-8-4-5-9-21(19)32-24/h1-12H,27H2 |
| InChIKey | QDXBVFLFEZWUGO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|