C18H9N5OS — CID 4571773
2-amino-4-[5-(1,3-benzothiazol-2-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 4571773) has the molecular formula C18H9N5OS and a molecular weight of 343.37 g/mol. Its IUPAC name is 2-amino-4-[5-(1,3-benzothiazol-2-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-[5-(1,3-benzothiazol-2-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 4571773 |
| Molecular Formula | C18H9N5OS |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-amino-4-[5-(1,3-benzothiazol-2-yl)furan-2-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(=Cc1ccc(-c2nc3ccccc3s2)o1)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C18H9N5OS/c19-8-11(17(22)12(9-20)10-21)7-13-5-6-15(24-13)18-23-14-3-1-2-4-16(14)25-18/h1-7H,22H2 |
| InChIKey | IJEIILWFVRLGRM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|