C14H9NO3S — CID 4961866
3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enoic acid (PubChem CID 4961866) has the molecular formula C14H9NO3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4961866 |
| Molecular Formula | C14H9NO3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C14H9NO3S/c16-13(17)8-6-9-5-7-11(18-9)14-15-10-3-1-2-4-12(10)19-14/h1-8H,(H,16,17) |
| InChIKey | UZOULHXGHWZJSM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|