C18H13N3O2S — CID 78905861
3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 78905861) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78905861 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cn1cc(C(=O)C=Cc2ccc(-c3nc4ccccc4s3)o2)cn1 |
| InChI | InChI=1S/C18H13N3O2S/c1-21-11-12(10-19-21)15(22)8-6-13-7-9-16(23-13)18-20-14-4-2-3-5-17(14)24-18/h2-11H,1H3 |
| InChIKey | ZFDIXNFSPIMLRL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|