C18H10N2OS2 — CID 854969
2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1,3-benzothiazole (PubChem CID 854969) has the molecular formula C18H10N2OS2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 854969 |
| Molecular Formula | C18H10N2OS2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-[5-(1,3-benzothiazol-2-yl)furan-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(-c3ccc(-c4nc5ccccc5s4)o3)nc2c1 |
| InChI | InChI=1S/C18H10N2OS2/c1-3-7-15-11(5-1)19-17(22-15)13-9-10-14(21-13)18-20-12-6-2-4-8-16(12)23-18/h1-10H |
| InChIKey | MPZLMUYUIBRMGP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |