C18H12ClNOS — CID 126195133
2-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1,3-benzothiazole (PubChem CID 126195133) has the molecular formula C18H12ClNOS and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 126195133 |
| Molecular Formula | C18H12ClNOS |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-[5-(5-chloro-2-methylphenyl)furan-2-yl]-1,3-benzothiazole |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C18H12ClNOS/c1-11-6-7-12(19)10-13(11)15-8-9-16(21-15)18-20-14-4-2-3-5-17(14)22-18/h2-10H,1H3 |
| InChIKey | BRDKSAMJABVXEF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |