C17H10Cl2N2S — CID 155806756
2-(2,8-dichloro-7-methylquinolin-3-yl)-1,3-benzothiazole (PubChem CID 155806756) has the molecular formula C17H10Cl2N2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 2-(2,8-dichloro-7-methylquinolin-3-yl)-1,3-benzothiazole.
| Compound Name | 2-(2,8-dichloro-7-methylquinolin-3-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 155806756 |
| Molecular Formula | C17H10Cl2N2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2-(2,8-dichloro-7-methylquinolin-3-yl)-1,3-benzothiazole |
| SMILES | Cc1ccc2cc(-c3nc4ccccc4s3)c(Cl)nc2c1Cl |
| InChI | InChI=1S/C17H10Cl2N2S/c1-9-6-7-10-8-11(16(19)21-15(10)14(9)18)17-20-12-4-2-3-5-13(12)22-17/h2-8H,1H3 |
| InChIKey | VSNAGJRVRWELCY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|