C22H11Cl3N2S — CID 2336016
2-[2-(2,3,4-trichlorophenyl)quinolin-4-yl]-1,3-benzothiazole (PubChem CID 2336016) has the molecular formula C22H11Cl3N2S and a molecular weight of 441.77 g/mol. Its IUPAC name is 2-[2-(2,3,4-trichlorophenyl)quinolin-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[2-(2,3,4-trichlorophenyl)quinolin-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2336016 |
| Molecular Formula | C22H11Cl3N2S |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 2-[2-(2,3,4-trichlorophenyl)quinolin-4-yl]-1,3-benzothiazole |
| SMILES | Clc1ccc(-c2cc(-c3nc4ccccc4s3)c3ccccc3n2)c(Cl)c1Cl |
| InChI | InChI=1S/C22H11Cl3N2S/c23-15-10-9-13(20(24)21(15)25)18-11-14(12-5-1-2-6-16(12)26-18)22-27-17-7-3-4-8-19(17)28-22/h1-11H |
| InChIKey | NOZAIRKFBITPMZ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|