C13H8ClNO2S — CID 972656
4-(1,3-benzothiazol-2-yl)-3-chlorobenzene-1,2-diol (PubChem CID 972656) has the molecular formula C13H8ClNO2S and a molecular weight of 277.73 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-chlorobenzene-1,2-diol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-chlorobenzene-1,2-diol |
|---|---|
| PubChem CID | 972656 |
| Molecular Formula | C13H8ClNO2S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-chlorobenzene-1,2-diol |
| SMILES | Oc1ccc(-c2nc3ccccc3s2)c(Cl)c1O |
| InChI | InChI=1S/C13H8ClNO2S/c14-11-7(5-6-9(16)12(11)17)13-15-8-3-1-2-4-10(8)18-13/h1-6,16-17H |
| InChIKey | HEXMNPLNRAHYSU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|