C19H13NO3S — CID 176656530
4-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]benzene-1,2-diol (PubChem CID 176656530) has the molecular formula C19H13NO3S and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]benzene-1,2-diol.
| Compound Name | 4-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 176656530 |
| Molecular Formula | C19H13NO3S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-[3-(1,3-benzothiazol-2-yl)-2-hydroxyphenyl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2cccc(-c3nc4ccccc4s3)c2O)cc1O |
| InChI | InChI=1S/C19H13NO3S/c21-15-9-8-11(10-16(15)22)12-4-3-5-13(18(12)23)19-20-14-6-1-2-7-17(14)24-19/h1-10,21-23H |
| InChIKey | RBLGXZMFTLZULW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|