C14H9NO3S — CID 141481149
3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoic acid (PubChem CID 141481149) has the molecular formula C14H9NO3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 141481149 |
| Molecular Formula | C14H9NO3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H9NO3S/c16-11-6-5-8(14(17)18)7-9(11)13-15-10-3-1-2-4-12(10)19-13/h1-7,16H,(H,17,18) |
| InChIKey | NIAKBRFBJNGJRR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |