C22H14FN3O3S2 — CID 135799721
N-[2-[3-(1,3-benzothiazol-2-yl)-4-hydroxyanilino]-2-oxoethanethioyl]-4-fluorobenzamide (PubChem CID 135799721) has the molecular formula C22H14FN3O3S2 and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[2-[3-(1,3-benzothiazol-2-yl)-4-hydroxyanilino]-2-oxoethanethioyl]-4-fluorobenzamide.
| Compound Name | N-[2-[3-(1,3-benzothiazol-2-yl)-4-hydroxyanilino]-2-oxoethanethioyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 135799721 |
| Molecular Formula | C22H14FN3O3S2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[2-[3-(1,3-benzothiazol-2-yl)-4-hydroxyanilino]-2-oxoethanethioyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(O)c(-c2nc3ccccc3s2)c1)C(=S)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H14FN3O3S2/c23-13-7-5-12(6-8-13)19(28)26-21(30)20(29)24-14-9-10-17(27)15(11-14)22-25-16-3-1-2-4-18(16)31-22/h1-11,27H,(H,24,29)(H,26,28,30) |
| InChIKey | BQWAHBDHZUBUOU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|