C21H14N4O4S2 — CID 3747081
N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-4-nitrobenzamide (PubChem CID 3747081) has the molecular formula C21H14N4O4S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3747081 |
| Molecular Formula | C21H14N4O4S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-4-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(-c2nc3ccccc3s2)c(O)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14N4O4S2/c26-17-11-13(7-10-15(17)20-23-16-3-1-2-4-18(16)31-20)22-21(30)24-19(27)12-5-8-14(9-6-12)25(28)29/h1-11,26H,(H2,22,24,27,30) |
| InChIKey | NXQHIKJXLARFSJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|