C25H15ClN4O4S2 — CID 4602056
N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 4602056) has the molecular formula C25H15ClN4O4S2 and a molecular weight of 535.01 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4602056 |
| Molecular Formula | C25H15ClN4O4S2 |
| Molecular Weight | 535.01 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3s2)c1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C25H15ClN4O4S2/c26-18-9-8-15(13-17(18)24-28-19-6-1-2-7-22(19)36-24)27-25(35)29-23(31)21-11-10-20(34-21)14-4-3-5-16(12-14)30(32)33/h1-13H,(H2,27,29,31,35) |
| InChIKey | DYNVGYMCQYQRFB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|