C25H14Cl3N3O2S2 — CID 3965366
N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 3965366) has the molecular formula C25H14Cl3N3O2S2 and a molecular weight of 558.90 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3965366 |
| Molecular Formula | C25H14Cl3N3O2S2 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 556.96 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(-c2nc3ccccc3s2)c(Cl)cc1Cl)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C25H14Cl3N3O2S2/c26-14-5-3-4-13(10-14)20-8-9-21(33-20)23(32)31-25(34)30-19-11-15(16(27)12-17(19)28)24-29-18-6-1-2-7-22(18)35-24/h1-12H,(H2,30,31,32,34) |
| InChIKey | USHBPRHRYOJABH-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|