C27H15Cl4N3O2S2 — CID 17315791
(E)-N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17315791) has the molecular formula C27H15Cl4N3O2S2 and a molecular weight of 619.38 g/mol. Its IUPAC name is (E)-N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17315791 |
| Molecular Formula | C27H15Cl4N3O2S2 |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 616.94 |
| IUPAC Name | (E)-N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1cc(-c2nc3ccccc3s2)c(Cl)cc1Cl |
| InChI | InChI=1S/C27H15Cl4N3O2S2/c28-15-9-14(10-16(29)11-15)23-7-5-17(36-23)6-8-25(35)34-27(37)33-22-12-18(19(30)13-20(22)31)26-32-21-3-1-2-4-24(21)38-26/h1-13H,(H2,33,34,35,37)/b8-6+ |
| InChIKey | GORUWHQASOSZHL-SOFGYWHQSA-N |
| XLogP | 9.36 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|