C26H14Cl4N2O2S — CID 3673268
N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3673268) has the molecular formula C26H14Cl4N2O2S and a molecular weight of 560.29 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3673268 |
| Molecular Formula | C26H14Cl4N2O2S |
| Molecular Weight | 560.29 g/mol |
| Exact Mass | 557.95 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1cc(-c2nc3ccccc3s2)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H14Cl4N2O2S/c27-17-5-3-4-15(25(17)30)22-10-8-14(34-22)9-11-24(33)31-21-12-16(18(28)13-19(21)29)26-32-20-6-1-2-7-23(20)35-26/h1-13H,(H,31,33) |
| InChIKey | MGJFUMVSNMQOMA-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.29 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|