C23H15Cl2NO2 — CID 4528607
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide (PubChem CID 4528607) has the molecular formula C23H15Cl2NO2 and a molecular weight of 408.28 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4528607 |
| Molecular Formula | C23H15Cl2NO2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-naphthalen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H15Cl2NO2/c24-20-7-3-6-19(23(20)25)21-12-10-18(28-21)11-13-22(27)26-17-9-8-15-4-1-2-5-16(15)14-17/h1-14H,(H,26,27) |
| InChIKey | LNEDWIWLYKJNFQ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|