C26H16Cl3N3O2 — CID 5151928
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 5151928) has the molecular formula C26H16Cl3N3O2 and a molecular weight of 508.79 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5151928 |
| Molecular Formula | C26H16Cl3N3O2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C26H16Cl3N3O2/c27-19-11-8-15(14-18(19)26-31-21-6-1-2-7-22(21)32-26)30-24(33)13-10-16-9-12-23(34-16)17-4-3-5-20(28)25(17)29/h1-14H,(H,30,33)(H,31,32) |
| InChIKey | UAQVAVGGBDHWBT-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|