C18H11ClIN3O2 — CID 1361388
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-5-iodofuran-2-carboxamide (PubChem CID 1361388) has the molecular formula C18H11ClIN3O2 and a molecular weight of 463.66 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-5-iodofuran-2-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-5-iodofuran-2-carboxamide |
|---|---|
| PubChem CID | 1361388 |
| Molecular Formula | C18H11ClIN3O2 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-5-iodofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1)c1ccc(I)o1 |
| InChI | InChI=1S/C18H11ClIN3O2/c19-12-6-5-10(21-18(24)15-7-8-16(20)25-15)9-11(12)17-22-13-3-1-2-4-14(13)23-17/h1-9H,(H,21,24)(H,22,23) |
| InChIKey | NYRBFMLVTKJTPK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|