C21H14ClN3O3 — CID 2208803
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 2208803) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 2208803 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H14ClN3O3/c22-15-7-6-13(10-14(15)20-24-16-3-1-2-4-17(16)25-20)23-21(26)12-5-8-18-19(9-12)28-11-27-18/h1-10H,11H2,(H,23,26)(H,24,25) |
| InChIKey | GZGQEEBZWHJLRO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |