C24H21ClN4O3S — CID 110162725
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 110162725) has the molecular formula C24H21ClN4O3S and a molecular weight of 480.98 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 110162725 |
| Molecular Formula | C24H21ClN4O3S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1)c1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C24H21ClN4O3S/c25-20-11-10-17(15-19(20)23-27-21-8-1-2-9-22(21)28-23)26-24(30)16-6-5-7-18(14-16)29-12-3-4-13-33(29,31)32/h1-2,5-11,14-15H,3-4,12-13H2,(H,26,30)(H,27,28) |
| InChIKey | PPDGBPRITMFJFU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |