C24H17ClN4O3S2 — CID 110162739
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 110162739) has the molecular formula C24H17ClN4O3S2 and a molecular weight of 509.01 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 110162739 |
| Molecular Formula | C24H17ClN4O3S2 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H17ClN4O3S2/c25-19-12-11-17(14-18(19)23-27-20-4-1-2-5-21(20)28-23)26-24(30)15-7-9-16(10-8-15)29-34(31,32)22-6-3-13-33-22/h1-14,29H,(H,26,30)(H,27,28) |
| InChIKey | NGPRLMGEMUQWMH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |